CAS 1850305-91-7
:B-(Cyclopropyl-1,2,2,3,3-d5)boronic acid
Description:
B-(Cyclopropyl-1,2,2,3,3-d5)boronic acid is a boronic acid derivative characterized by the presence of a cyclopropyl group and deuterated carbon atoms, which are indicated by the "d5" in its name. This compound features a boron atom bonded to a hydroxyl group and an organic substituent, which in this case is a cyclopropyl ring that has been fully deuterated at specific positions. The presence of deuterium isotopes can influence the compound's reactivity and stability, making it useful in various applications, including medicinal chemistry and synthetic organic chemistry, particularly in studies involving isotopic labeling. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in the synthesis of complex organic molecules and in the development of sensors and drug delivery systems. The unique structural features of B-(Cyclopropyl-1,2,2,3,3-d5)boronic acid may also provide insights into reaction mechanisms and the behavior of boron-containing compounds in different chemical environments.
Formula:C3H2BD5O2
InChI:InChI=1S/C3H7BO2/c5-4(6)3-1-2-3/h3,5-6H,1-2H2/i1D2,2D2,3D
InChI key:InChIKey=WLVKDFJTYKELLQ-UXXIZXEISA-N
SMILES:B(O)(O)C1(C(C1([2H])[2H])([2H])[2H])[2H]
Synonyms:- Boronic acid, B-(cyclopropyl-1,2,2,3,3-d5)-
- B-(Cyclopropyl-1,2,2,3,3-d5)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclopropyl-d5-boronic Acid
CAS:Controlled Product<p>Applications Cyclopropyl-d5-boronic Acid is a deuterated version of Cyclopropylboronic Acid (C988620), an organoboronic acid commonly used in highly efficient Suzuki coupling reactions.<br>References Ma, S. et al.: Adv. Synth. Cat., 348, 2114 (2006)<br></p>Formula:C3D5H2BO2Color and Shape:NeatMolecular weight:90.928
