CAS 18504-80-8

[(3-nitropyridin-2-yl)sulfanyl]acetic acid

Description:

[(3-nitropyridin-2-yl)sulfanyl]acetic acid, with the CAS number 18504-80-8, is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring substituted with a nitro group at the 3-position and a sulfanyl (thioether) group linked to an acetic acid moiety. This compound exhibits both acidic and nucleophilic properties due to the presence of the carboxylic acid group and the sulfur atom, respectively. The nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and interactions in various chemical environments. The compound may be utilized in organic synthesis, medicinal chemistry, or as a building block for more complex molecules. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, [(3-nitropyridin-2-yl)sulfanyl]acetic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₇H₆N₂O₄S

InChI: InChI=1/C7H6N2O4S/c10-6(11)4-14-7-5(9(12)13)2-1-3-8-7/h1-3H,4H2,(H,10,11)

SMILES: c1cc(c(nc1)SCC(=O)O)N(=O)=O

Synonyms:

• 2-[(3-Nitro-2-Pyridyl)Thio]Acetic Acid

[(3-Nitropyridin-2-yl)thio]acetic acid

CAS: 18504-80-8

[(3-Nitropyridin-2-yl)thio]acetic acid

Purity: 95%

Molecular weight: 214.20g/mol

Ref: 54-OR3908