CAS 18504-86-4

2H-pyrido[4,3-b][1,4]thiazin-3(4H)-one

Description:

2H-pyrido[4,3-b][1,4]thiazin-3(4H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a thiazine moiety. This compound features a sulfur atom within its ring system, contributing to its chemical reactivity and potential biological activity. It typically exhibits properties such as moderate solubility in polar solvents and may display various functional groups that influence its reactivity and interactions with other molecules. The presence of the thiazine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit antimicrobial or anti-inflammatory properties. Additionally, the compound's stability and reactivity can be influenced by substituents on the rings, making it a subject of interest for further research in organic synthesis and drug development. Overall, 2H-pyrido[4,3-b][1,4]thiazin-3(4H)-one represents a versatile scaffold for exploring new chemical entities with potential therapeutic applications.

Formula: C₇H₆N₂OS

InChI: InChI=1/C7H6N2OS/c10-7-4-11-6-1-2-8-3-5(6)9-7/h1-3H,4H2,(H,9,10)

SMILES: c1cncc2c1SCC(=N2)O

2H,3H,4H-Pyrido[4,3-b][1,4]thiazin-3-one

CAS: 18504-86-4

Versatile small molecule scaffold

Formula: C₇H₆N₂OS

Purity: Min. 95%

Molecular weight: 166.2 g/mol

Ref: 3D-TAA50486