CAS 18507-09-0

1-[(4-methoxynaphthalen-1-yl)oxy]-3-[(1-methylethyl)amino]propan-2-ol

Description:

1-[(4-Methoxynaphthalen-1-yl)oxy]-3-[(1-methylethyl)amino]propan-2-ol, with CAS number 18507-09-0, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and an isopropylamine group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the methoxy group enhances its solubility in organic solvents, while the amino group may impart basic characteristics, allowing for interactions with various biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could influence receptor binding and activity. Additionally, its synthesis and stability under various conditions would be important considerations for practical applications. As with many organic compounds, safety data and handling precautions should be reviewed before use.

Formula: C₁₇H₂₃NO₃

InChI: InChI=1/C17H23NO3/c1-12(2)18-10-13(19)11-21-17-9-8-16(20-3)14-6-4-5-7-15(14)17/h4-9,12-13,18-19H,10-11H2,1-3H3

SMILES: CC(C)NCC(COc1ccc(c2ccccc12)OC)O

Synonyms:

• 1-(Isopropylamino)-3-((4-methoxy-1-naphthyl)oxy)-2-propanol
• 2-Propanol, 1-(isopropylamino)-3-((4-methoxy-1-naphthyl)oxy)-

4-Methoxy propranolol

CAS: 18507-09-0

4-Methoxy propranolol is an intermediate in the synthesis of propranolol, a beta blocker.

Formula: C₁₇H₂₃NO₃

Purity: Min. 95%

Molecular weight: 289.37 g/mol

Ref: 3D-FM25187