CAS 1851-09-8

4-Chlorophenylsulfonylacetonitrile

Description:

4-Chlorophenylsulfonylacetonitrile, with the CAS number 1851-09-8, is an organic compound characterized by its sulfonamide functional group and a nitrile group. It features a chlorinated phenyl ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the sulfonyl group enhances its ability to participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its chemical structure allows for interactions with biological systems, which may lead to specific biological activities. Safety data indicates that, like many sulfonyl compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 4-Chlorophenylsulfonylacetonitrile is a versatile compound with significant implications in synthetic chemistry and medicinal research.

Formula: C₈H₆ClNO₂S

InChI: InChI=1/C8H6ClNO2S/c9-7-1-3-8(4-2-7)13(11,12)6-5-10/h1-4H,6H2

SMILES: c1cc(ccc1Cl)S(=O)(=O)CC#N

Synonyms:

• (4-Chlorobenzenesulfonyl)Acetonitrile

4-Chlorophenylsulfonylacetonitrile

CAS: 1851-09-8

Formula: C₈H₆ClNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.6567

Ref: IN-DA003L85

[(4-Chlorophenyl)sulphonyl]acetonitrile

CAS: 1851-09-8

[(4-Chlorophenyl)sulphonyl]acetonitrile

Formula: C₈H₆ClNO₂S

Purity: 98%

Color and Shape: powder

Molecular weight: 215.66g/mol

Ref: 54-OR0123

4-Chlorobenzenesulfonylacetonitrile

CAS: 1851-09-8

Formula: C₈H₆ClNO₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 215.65

Ref: 10-F011125

2-(4-Chlorobenzenesulphonyl)acetonitrile

CAS: 1851-09-8

2-(4-Chlorobenzenesulphonyl)acetonitrile is a reactive chemical that is synthesized from chloroform and acetonitrile. It can be used to synthesize various medicines such as analgesics, muscle relaxants, and x-ray contrast agents. 2-(4-Chlorobenzenesulphonyl)acetonitrile has minimal effects on the human body and is not known to cause any major health problems. It is metabolized in the liver by oxidation of the methyl group to form 4-chlorobenzene sulfonic acid, which is excreted through urine. The chlorine atom in this molecule has a trigonal bipyramidal geometry with a bond length of 1.82 Å, which can be seen in x-ray crystallography studies.

Formula: C₈H₆ClNO₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 215.66 g/mol

Ref: 3D-FC36027