CAS 185129-92-4

2-(4-Nitrophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline

Description:

2-(4-Nitrophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline is a complex organic compound characterized by its fused heterocyclic structure, which incorporates both imidazole and phenanthroline moieties. This compound typically exhibits strong absorption in the ultraviolet-visible (UV-Vis) spectrum due to its extended π-conjugated system, making it useful in various photophysical applications. The presence of the nitrophenyl group introduces electron-withdrawing characteristics, which can influence the compound's electronic properties and reactivity. It is often studied for its potential applications in fields such as coordination chemistry, photochemistry, and as a ligand in metal complexes. Additionally, the compound may exhibit interesting biological activities, including potential antitumor or antimicrobial properties, although specific biological data would depend on further empirical studies. Its solubility and stability can vary based on the solvent and environmental conditions, which are important factors to consider in experimental applications. Overall, this compound represents a significant interest in both synthetic and applied chemistry due to its unique structural features and potential functionalities.

Formula: C₁₉H₁₁N₅O₂

InChI: InChI=1S/C19H11N5O2/c25-24(26)12-7-5-11(6-8-12)19-22-17-13-3-1-9-20-15(13)16-14(18(17)23-19)4-2-10-21-16/h1-10H,(H,22,23)

InChI key: InChIKey=VEJNRFLXIYPBAG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(C=2NC=3C(=C4C(=C5C3C=CC=N5)N=CC=C4)N2)C=C1

Synonyms:

• 1H-Imidazo[4,5-f][1,10]phenanthroline, 2-(4-nitrophenyl)-
• 2-(4-Nitrophenyl)imidazo[4,5-f][1,10]phenanthroline
• 2-(4-Nitrophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline