CAS 18516-19-3

Propanal, 2,2-dimethyl-3-[[(4-methylphenyl)sulfonyl]oxy]-

Description:

Propanal, 2,2-dimethyl-3-[[(4-methylphenyl)sulfonyl]oxy]- is an organic compound characterized by its structure, which includes a propanal group, a sulfonate ester, and a branched alkyl chain. The presence of the sulfonyl group indicates that it may exhibit properties typical of sulfonate esters, such as increased solubility in polar solvents and potential reactivity in nucleophilic substitution reactions. The compound's branched structure contributes to its steric hindrance, which can influence its reactivity and interaction with other molecules. Additionally, the presence of the 4-methylphenyl group suggests potential aromatic characteristics, which may affect its stability and reactivity. This compound may be utilized in various chemical syntheses or as an intermediate in organic chemistry. Its specific applications would depend on its reactivity and the functional groups present. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₆O₄S

InChI: InChI=1S/C12H16O4S/c1-10-4-6-11(7-5-10)17(14,15)16-9-12(2,3)8-13/h4-8H,9H2,1-3H3

InChI key: InChIKey=ZETOSWREBWGSHW-UHFFFAOYSA-N

SMILES: S(OCC(C=O)(C)C)(=O)(=O)C1=CC=C(C)C=C1

Synonyms:

• 2,2-Dimethyl-3-oxopropyl 4-methylbenzenesulfonate
• (2,2-Dimethyl-3-oxopropyl) 4-methylbenzenesulfonate
• 2,2-Dimethyl-3-[[(4-methylphenyl)sulfonyl]oxy]propanal
• Hydracrylaldehyde, 2,2-dimethyl-, p-toluenesulfonate
• Propanal, 2,2-dimethyl-3-[[(4-methylphenyl)sulfonyl]oxy]-

2,2-Dimethyl-3-[(4-methylbenzenesulfonyl)oxy]propanal

CAS: 18516-19-3

Versatile small molecule scaffold

Formula: C₁₂H₁₆O₄S

Purity: Min. 95%

Molecular weight: 256.32 g/mol

Ref: 3D-TAA51619