CAS 1852-04-6
:Undecanedioic acid
Description:
Undecanedioic acid, also known as sebacic acid, is a dicarboxylic acid with the molecular formula C11H20O4. It features a straight-chain structure with two carboxylic acid functional groups (-COOH) located at each end of an eleven-carbon alkane chain. This compound is a white, crystalline solid at room temperature and is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. Undecanedioic acid has a melting point that typically falls within a moderate range, making it useful in various applications. It is primarily utilized in the production of polyesters, plasticizers, and lubricants, and serves as an intermediate in the synthesis of various chemicals. Additionally, it has applications in the cosmetic and food industries due to its biodegradable nature. The compound is generally regarded as safe, but like many organic acids, it can be irritating to the skin and eyes, necessitating appropriate handling precautions.
Formula:C11H20O4
InChI:InChI=1S/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15)
InChI key:InChIKey=LWBHHRRTOZQPDM-UHFFFAOYSA-N
SMILES:C(CC(O)=O)CCCCCCCC(O)=O
Synonyms:- 1,11-Undecanedioic Acid
- 1,9-Nonanedicarboxylic acid
- 2-{[(3Α,5Β,7Β,8Ξ,9Ξ,12Α,14Ξ)-3,7,12-Trihydroxy-24-Oxocholan-24-Yl]Amino}Ethanesulfonic Acid
- 3,3',3'',3'''-[3,8,12,17-Tetrakis(Carboxymethyl)Porphyrin-2,7,13,18-Tetrayl]Tetrapropanoic Acid
- Hendecanedioic acid
- NSC 400241
- Undecanedioate
- 2-{[(3α,5β,7β,8ξ,9ξ,12α,14ξ)-3,7,12-trihydroxy-24-oxocholan-24-yl]amino}ethanesulfonic acid
- Undecanedioic acid
- TCI-N 0333
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
1,9-Nonanedicarboxylic Acid
CAS:Formula:C11H20O4Purity:>97.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:216.28Undecanedioic Acid
CAS:Acyclic polycarboxylic acids and their anhydrides, halides, peroxides and their derivatives, nesoiFormula:C11H20O4Color and Shape:White PowderMolecular weight:216.13616Undecanedioic Acid
CAS:Formula:C11H20O4Color and Shape:White To Off-White SolidMolecular weight:216.28Undecanedioic acid 97%
CAS:Formula:C11H20O4Purity:>98%Color and Shape:White SolidMolecular weight:216.27Undecane-1,11-dioic acid
CAS:<p>Undecane-1,11-dioic acid</p>Formula:C11H20O4Purity:97%Color and Shape: off white to light yellow crystalline solidMolecular weight:216.27g/molUndecanedioic acid
CAS:Undecanedioic acid in human aortas links to advanced atherosclerosis and elastin.Formula:C11H20O4Purity:99.97%Color and Shape:White To Yellowish FlakeMolecular weight:216.27Undecanedioic Acid
CAS:Controlled Product<p>Applications Undecanedioic Acid is a bioactive compound found in Polygala tenuifolia root which is used as a functional food due to its attractive health benefits.<br>References Wu, D., et. al.: J. Food Drug Anal., 23, 144 (2015)<br></p>Formula:C11H20O4Color and Shape:NeatMolecular weight:216.274









