CAS 185222-90-6

5-benzyl 3-methyl 2-methyl-6-phenyl-4-(phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate

Description:

5-Benzyl 3-methyl 2-methyl-6-phenyl-4-(phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate is a complex organic compound belonging to the class of dihydropyridines, which are known for their diverse biological activities, particularly in pharmacology. This compound features multiple functional groups, including ester and phenyl groups, contributing to its potential reactivity and solubility characteristics. Dihydropyridines are often studied for their role as calcium channel blockers and in various therapeutic applications, including cardiovascular health. The presence of multiple aromatic rings in this structure may enhance its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. Additionally, the compound's stereochemistry and substituent positions can significantly affect its pharmacological properties. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a significant area of interest in medicinal chemistry and drug development.

Formula: C₃₀H₂₅NO₄

InChI: InChI=1/C30H25NO4/c1-21-26(29(32)34-2)25(19-18-22-12-6-3-7-13-22)27(28(31-21)24-16-10-5-11-17-24)30(33)35-20-23-14-8-4-9-15-23/h3-17,25,31H,20H2,1-2H3

SMILES: CC1=C(C(C#Cc2ccccc2)C(=C(c2ccccc2)N1)C(=O)OCc1ccccc1)C(=O)OC

MRS 1191

CAS: 185222-90-6

Formula: C₃₁H₂₇NO₄

Molecular weight: 477.55

Ref: 7W-GK8686

MRS 1191

CAS: 185222-90-6

Adenoside A3 receptor antagonist

Formula: C₃₁H₂₇NO₄

Purity: Min. 95%

Molecular weight: 477.55 g/mol

Ref: 3D-FM172389

MRS-1191

CAS: 185222-90-6

MRS-1191 is an effective and selective A3 adenosine receptor antagonist (KB: 92 nM, a Ki: 31.4 nM for human A3 receptor and an IC50: 120 nM for CHO cells).

Formula: C₃₁H₂₇NO₄

Color and Shape: Solid

Molecular weight: 477.55

Ref: TM-T16134