CAS 18523-48-3
:2-Azidoacetic acid
Description:
2-Azidoacetic acid is an organic compound characterized by the presence of an azide functional group (-N3) and a carboxylic acid group (-COOH). Its molecular structure consists of a two-carbon chain with the azide group attached to the second carbon. This compound is typically a white to pale yellow solid and is known for its potential applications in organic synthesis, particularly in the field of click chemistry, where it can participate in various coupling reactions. 2-Azidoacetic acid is also notable for its reactivity; the azide group can undergo thermal decomposition, leading to the release of nitrogen gas, which can be hazardous. Additionally, the compound is soluble in polar solvents, making it useful in various chemical reactions. Safety precautions are essential when handling this substance due to its explosive nature under certain conditions. Overall, 2-azidoacetic acid serves as a valuable intermediate in the synthesis of more complex molecules in medicinal chemistry and materials science.
Formula:C2H3N3O2
InChI:InChI=1/C2H3N3O2/c3-5-4-1-2(6)7/h1H2,(H,6,7)
InChI key:InChIKey=PPXUUPXQWDQNGO-UHFFFAOYSA-N
SMILES:C(C(O)=O)N=[N+]=[N-]
Synonyms:- 2-Azidoacetic acid
- Acetic acid, 2-azido-
- Acetic acid, azido-
- Azidoacetic Acid
- 2-Azidoacetic acid 97%
- Triazoacetic acid
- 2-Azidoacetic acid,Azide Acetic Acid
- Azide Acetic Acid
- triazidoacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Azidoacetic Acid
CAS:Formula:C2H3N3O2Purity:>97.0%(GC)Color and Shape:White or Colorless to Light yellow to Light orange powder to lump to clear liquidMolecular weight:101.072-Azidoacetic acid
CAS:2-Azidoacetic acid is a versatile chemical building block that can be used to form amides by reaction of the carboxylic acid with a suitable coupling reagent and amine. The azide group can undergo copper(I) catalysed or Huisgen 1,3-dipolar cycloadditin reactions to form triazoles, a common example of click chemistry.Formula:C2H3N3O2Purity:Min. 97.0 Area-%Color and Shape:Colorless Slightly Yellow Clear Liquid PowderMolecular weight:101.06 g/molAzidoacetic Acid
CAS:Azidoacetic Acid (2-Azidoacetic acid) (compound 92-1), a click chemistry reagent featuring an azide group, serves as a versatile small molecule tool in the synthesis of PROTAC [1].Formula:C2H3N3O2Color and Shape:SolidMolecular weight:101.0641



