CAS 18527-12-3
:2-(4-Chlorophenylthio)Propanoic Acid
Description:
2-(4-Chlorophenylthio)propanoic acid, with the CAS number 18527-12-3, is an organic compound characterized by its unique structure, which includes a propanoic acid moiety and a 4-chlorophenylthio group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and agrochemicals. The presence of the chlorophenylthio group enhances its biological activity, making it of interest in various chemical research fields. It is generally soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the chlorophenyl group. The compound may exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled. Overall, 2-(4-Chlorophenylthio)propanoic acid is a compound of interest for its chemical properties and potential applications in various scientific domains.
Formula:C9H8ClO2S
InChI:InChI=1/C9H9ClO2S/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12)/p-1/t6-/m1/s1
SMILES:C[C@H](C(=O)[O-])Sc1ccc(cc1)Cl
Synonyms:- Zerenex E/6020007
- (2S)-2-[(4-chlorophenyl)sulfanyl]propanoate
- (2R)-2-[(4-chlorophenyl)sulfanyl]propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-Chlorophenylthio)propanoic acid
CAS:Formula:C9H9ClO2SPurity:97%Color and Shape:Solid, White solidMolecular weight:216.682-(4-Chlorophenylthio)propanoic acid
CAS:2-(4-Chlorophenylthio)propanoic acid is a metabolite of propanoic acid, and has been identified as having an important role in the metabolism of fatty acids. It is produced during oxidation reactions by bacteria or other microbes. 2-(4-Chlorophenylthio)propanoic acid is preferentially oxidized to carboxylic acids, such as oxalic acid, malonic acid, and succinic acid, which are further metabolized to form carbon dioxide and water. The conversion of propanoic acid to 2-(4-chlorophenylthio)propanoic acid provides a pathway for the degradation of fatty acids.
Formula:C9H9ClO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:216.68 g/mol


