
CAS 185379-39-9: (R)-N-FMOC-(2-Pyridyl)alanine
Description:(R)-N-FMOC-(2-Pyridyl)alanine is a chiral amino acid derivative characterized by the presence of a 2-pyridyl group and a fluorenylmethyloxycarbonyl (FMOC) protecting group. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis, due to its ability to protect the amino group while allowing for further functionalization. The FMOC group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous for sequential coupling reactions. The 2-pyridyl moiety contributes to the compound's unique properties, including potential interactions in biological systems and its role in enhancing solubility and reactivity. As a chiral compound, (R)-N-FMOC-(2-Pyridyl)alanine can exhibit different biological activities compared to its enantiomer, making it significant in the development of pharmaceuticals and biologically active compounds. Its CAS number, 185379-39-9, allows for easy identification and reference in chemical databases and literature.
Formula:C23H19N2O4
InChI:InChI=1/C23H20N2O4/c26-22(27)21(13-15-7-5-6-12-24-15)25-23(28)29-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/p-1/t21-/m1/s1
- Synonyms:
- Fmoc-D-2-Pyridylalanine
- Fmoc-D-3-(2-Pyridyl)-alanine
- Fmoc-3-(2-Pyridyl)-D-alanine
- Fmoc-D-2-PAL-OH
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fmoc-2-D-Pal-OH REF: IN-DA003C8CCAS: 185379-39-9 | 97% | To inquire | Tue 15 Apr 25 |
![]() | Fmoc-β-(2-pyridyl)-D-Ala-OH REF: 7W-GM8509CAS: 185379-39-9 | - - - | To inquire | Mon 14 Apr 25 |
![]() | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyridin-2-yl)propanoic acid REF: 10-F463614CAS: 185379-39-9 | 95.0% | 40.00 €~673.00 € | Wed 16 Apr 25 |
![]() | Fmoc-3-(2'-pyridyl)-D-alanine REF: 3D-FF48231CAS: 185379-39-9 | Min. 95% | - - - | Discontinued product |

Fmoc-2-D-Pal-OH
Ref: IN-DA003C8C
1g | 57.00 € | ||
5g | 159.00 € | ||
10g | 314.00 € | ||
100mg | 25.00 € | ||
250mg | 38.00 € |

(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyridin-2-yl)propanoic acid
Ref: 10-F463614
1g | 40.00 € | ||
5g | 174.00 € | ||
10g | 315.00 € | ||
25g | 673.00 € |

Fmoc-3-(2'-pyridyl)-D-alanine
Ref: 3D-FF48231
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |