CymitQuimica logo

CAS 18542-37-5

:

(3aR,4S,5aR,9aR,9bR)-5a-Ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-2H-furo[2,3-f][2]benzopyran-2,8(3H)-dione

Description:
The chemical substance with the name "(3aR,4S,5aR,9aR,9bR)-5a-Ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-2H-furo[2,3-f][2]benzopyran-2,8(3H)-dione" and CAS number "18542-37-5" is a complex organic compound characterized by its unique bicyclic structure, which includes a furobenzopyran moiety. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration and potentially influencing its biological activity. The presence of hydroxy and ethenyl functional groups suggests that it may exhibit interesting chemical reactivity and solubility properties. Additionally, the dione functionality indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its structural complexity may also imply potential applications in fields such as medicinal chemistry or materials science, where compounds with specific stereochemistry and functional groups can exhibit unique properties. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.
Formula:C15H16O5
InChI:InChI=1S/C15H16O5/c1-4-15-5-9(16)10-7(2)14(18)20-12(10)11(15)8(3)13(17)19-6-15/h4,9-12,16H,1-3,5-6H2/t9-,10+,11+,12-,15+/m0/s1
InChI key:InChIKey=IFYQXAXVZGMFNW-MVIRXUPPSA-N
SMILES:C(=C)[C@@]12[C@@]([C@@]3([C@@]([C@@H](O)C1)(C(=C)C(=O)O3)[H])[H])(C(=C)C(=O)OC2)[H]
Synonyms:
  • 2H-Furo[2,3-f][2]benzopyran-2,8(3H)-dione, 3aβ,4,5,5a,6,9,9aβ,9bα-octahydro-4β-hydroxy-3,9-dimethylene-5aβ-vinyl-, (+)-
  • (3aR,4S,5aR,9aR,9bR)-5a-Ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-2H-furo[2,3-f][2]benzopyran-2,8(3H)-dione
  • 2H-Furo[2,3-f][2]benzopyran-2,8(3H)-dione, 5a-ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-, [3aR-(3aα,4α,5aα,9aα,9bβ)]-
  • 2H-Furo[2,3-f][2]benzopyran-2,8(3H)-dione, 5a-ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-, (3aR,4S,5aR,9aR,9bR)-
  • Vernolepin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.