CAS 185448-73-1

2-CHLORO-3',4'-BIS(PIVALOYLOXY)ACETOPHENONE

Description:

2-Chloro-3',4'-bis(pivaloyloxy)acetophenone, with the CAS number 185448-73-1, is an organic compound characterized by its complex structure, which includes a chloro substituent and two pivaloyloxy groups attached to an acetophenone backbone. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential reactivity in various chemical processes. The presence of the chloro group may enhance its electrophilic character, making it useful in synthetic applications, particularly in organic synthesis and photochemistry. The pivaloyloxy groups can provide steric hindrance, influencing the compound's solubility and reactivity. Additionally, this substance may be utilized in the development of photoinitiators or as an intermediate in the synthesis of more complex molecules. Its stability and behavior under different conditions, such as temperature and light exposure, are essential for its applications in research and industry. As with all chemical substances, appropriate safety measures should be taken when handling this compound due to its potential hazards.

Formula: C₁₈H₂₃ClO₅

InChI: InChI=1/C18H23ClO5/c1-17(2,3)15(21)23-13-8-7-11(12(20)10-19)9-14(13)24-16(22)18(4,5)6/h7-9H,10H2,1-6H3

SMILES: CC(C)(C)C(=O)Oc1ccc(cc1OC(=O)C(C)(C)C)C(=O)CCl

Synonyms:

• 4-(Chloroacetyl)-1,2-phenylene bis(2,2-dimethylpropanoate)
• Propanoic Acid, 2,2-Dimethyl-, 4-(2-Chloroacetyl)-1,2-Phenylene Ester
• [5-(2-Chloroacetyl)-2-(2,2-Dimethylpropanoyloxy)Phenyl] 2,2-Dimethylpropanoate