CAS 18546-02-6
:6-deoxyaltrose
Description:
6-Deoxyaltrose is a monosaccharide, specifically a hexose, characterized by the absence of a hydroxyl group at the sixth carbon position, which distinguishes it from its parent sugar, altrose. This modification results in unique chemical properties and reactivity. The molecular formula of 6-deoxyaltrose is C6H12O5, indicating it contains six carbon atoms, twelve hydrogen atoms, and five oxygen atoms. It typically exists in a cyclic form, commonly as a pyranose, and can participate in various chemical reactions, including oxidation and reduction, due to the presence of functional groups. 6-Deoxyaltrose is of interest in biochemical research and may have applications in the synthesis of glycosides or as a building block in carbohydrate chemistry. Its structural characteristics can influence its interactions in biological systems, making it relevant in studies of metabolism and cellular processes. As with many sugars, it can also exhibit stereoisomerism, leading to different optical activities depending on the configuration of its hydroxyl groups.
Formula:C6H12O5
InChI:InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5-,6+/m1/s1
Synonyms:- 6-deoxy-D-altrose
- 6-Deoxy-L-altrose
- D-Altrose, 6-deoxy-
- 6-Deoxyaltrose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Deoxy-L-altrose
CAS:<p>6-Deoxy-L-altrose is a type of sugar that is found in human pathogens. It can be used as a biomarker for the identification of these types of bacteria. 6-Deoxy-L-altrose has been shown to have physiological activities against some bacterial strains, such as pseudotuberculosis and enterocolitica. 6-Deoxy-L-altrose is used as an extracellular metabolite by some bacteria, and has been shown to inhibit the growth of Mycobacterium tuberculosis through its ability to inhibit protein synthesis at the ribosomal level.</p>Formula:C6H12O5Purity:Min. 95%Molecular weight:164.16 g/mol
