CAS 18549-65-0
:7-DEAZAPURINE
Description:
7-Deazapurine is a purine analog characterized by the substitution of a nitrogen atom in the purine ring with a carbon atom, specifically at the 7-position. This modification alters its biological activity and properties compared to standard purines. The compound is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in various biochemical applications. 7-Deazapurine is of particular interest in medicinal chemistry and molecular biology due to its potential as an antiviral and anticancer agent, as it can interfere with nucleic acid metabolism. Its structural modifications can influence its interaction with enzymes and receptors, making it a valuable tool for studying purine metabolism and the development of therapeutic agents. Additionally, the compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in experimental settings. Overall, 7-deazapurine serves as a significant compound in research focused on nucleoside analogs and their therapeutic implications.
Formula:C20H18O3Si
InChI:InChI=1/C20H18O3Si/c24-20(23-18-14-8-3-9-15-18)19(21-16-10-4-1-5-11-16)22-17-12-6-2-7-13-17/h1-15H,24H3
SMILES:c1ccc(cc1)OC(=C(Oc1ccccc1)[SiH3])Oc1ccccc1
Synonyms:- 5H-Pyrrolo[2,3-D]Pyrimidine
- 5H-Pyrrolo[2,3-d]pyrimidine (8CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Deazapurine
CAS:Controlled ProductApplications 7-Deazapurine (cas# 18549-65-0) is a compound useful in organic synthesis.
Formula:C6H5N3Color and Shape:NeatMolecular weight:119.127-Deazapurine
CAS:7-Deazapurine is a cytostatic agent that inhibits the polymerase chain reaction by competitive inhibition of the incorporation of nucleotides into DNA. It has potent antitumor activity and significant cytotoxicity, which are due to its ability to inhibit DNA synthesis and cell division. 7-Deazapurine is also a nucleophilic compound that reacts with hydroxyl groups in DNA. The hydrolysis of 7-deazapurine by hydroxylases can be prevented by addition of high salt or trifluoroacetic acid, but this does not seem to affect its cytotoxic effects. 7-Deazapurine has been shown to have significant cytotoxicity against miapaca-2 cells and other cancer cell lines.Formula:C6H5N3Purity:Min. 95%Molecular weight:119.12 g/mol



