CAS 1855-23-8
:5-Cyclohexyl-2-hydroxybenzoic acid
Description:
5-Cyclohexyl-2-hydroxybenzoic acid, with the CAS number 1855-23-8, is an organic compound characterized by its aromatic structure, which includes a cyclohexyl group and a hydroxyl group attached to a benzoic acid framework. This compound typically exhibits properties associated with both carboxylic acids and phenolic compounds, such as acidity due to the carboxylic acid functional group and potential hydrogen bonding capabilities from the hydroxyl group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic cyclohexyl moiety. The presence of the hydroxyl group can enhance its reactivity, making it a candidate for various chemical reactions, including esterification and substitution. Additionally, its structural features may impart specific biological activities, making it of interest in pharmaceutical and material science research. Overall, 5-Cyclohexyl-2-hydroxybenzoic acid is a versatile compound with potential applications in various fields.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h6-9,14H,1-5H2,(H,15,16)
InChI key:InChIKey=GZEPXNUXMPYSOQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1O)C2CCCCC2
Synonyms:- 5-Cyclohexylsalicylic acid
- 5-Cyclohexyl-2-hydroxybenzenecarboxylic acid
- Salicylic acid, 5-cyclohexyl-
- 5-Cyclohexyl-2-hydroxybenzoic acid
- 5-cyclohexyl-2-hydroxybenzoic acid
- Benzoic acid, 5-cyclohexyl-2-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Cyclohexyl-2-hydroxybenzoic acid
CAS:<p>5-Cyclohexyl-2-hydroxybenzoic acid is a compound that belongs to the group of phenolic compounds. It has been clinically used for the treatment of systemic hypertension and is used in the manufacture of dyes, resins, flavors and fragrances. 5-Cyclohexyl-2-hydroxybenzoic acid can be found in light exposure, metal cations and environmental pollution. The use of this compound may lead to depression, which may be due to its effects on the vessel diameter. This drug also has an effect on blood pressure by stimulating vasodilatation through an endothelium-dependent mechanism.</p>Formula:C13H16O3Purity:Min. 95%Molecular weight:220.26 g/mol
