CAS 185545-90-8

(R)-1-(2-Fluorophenyl)ethylamine

Description:

(R)-1-(2-Fluorophenyl)ethylamine is an organic compound characterized by its chiral structure, which includes a fluorinated phenyl group and an ethylamine moiety. The presence of the fluorine atom on the aromatic ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interactions with biological targets. This compound is typically used in medicinal chemistry and pharmacological research due to its potential as a building block for various pharmaceuticals. The (R) configuration indicates that it has a specific spatial arrangement of atoms, which can significantly impact its biological activity and receptor binding affinity. Additionally, the compound's amine functional group may participate in hydrogen bonding, influencing its solubility and reactivity. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Overall, (R)-1-(2-Fluorophenyl)ethylamine is of interest in the development of therapeutic agents, particularly in the context of neuropharmacology and other fields where amine derivatives play a crucial role.

Formula: C₈H₁₀FN

InChI: InChI=1/C8H10FN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3

SMILES: CC(c1ccccc1F)N

Synonyms:

• R-Of-Pem
• (R)-1-(2-Fluorophenyl)ethanamine
• Benzenemethanamine, 2-fluoro-alpha-methyl-, (R)-
• Benzenemethanamine, 2-fluoro-α-methyl-, (αR)-
• (1R)-1-(2-fluorophenyl)ethanamine

(R)-1-(2-Fluorophenyl)ethanamine

CAS: 185545-90-8

Formula: C₈H₁₀FN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 139.1701

Ref: IN-DA0076SC

(1R)-1-(2-Fluorophenyl)ethylamine

CAS: 185545-90-8

(1R)-1-(2-Fluorophenyl)ethylamine

Formula: C₈H₁₀FN

Purity: ≥95%

Color and Shape: clear liquid

Molecular weight: 139.17g/mol

Ref: 54-PC0611

(R)-1-(2-FLUOROPHENYL)ETHANAMINE

CAS: 185545-90-8

Formula: C₈H₁₀FN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.173

Ref: 10-F301932