CAS 185547-14-2
:Piperazine, 1-(chloroacetyl)-4-(1-methylethyl)- (9CI)
Description:
Piperazine, 1-(chloroacetyl)-4-(1-methylethyl)-, also known by its CAS number 185547-14-2, is a chemical compound that belongs to the piperazine class of compounds, which are characterized by a six-membered ring containing two nitrogen atoms. This particular derivative features a chloroacetyl group and an isopropyl substituent, which contribute to its unique chemical properties. The presence of the chloroacetyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, while the isopropyl group may influence the compound's steric and electronic characteristics. Piperazine derivatives are often studied for their biological activities, including potential pharmaceutical applications, due to their ability to interact with various biological targets. The compound's solubility, stability, and reactivity can vary based on its functional groups and the surrounding environment. As with many piperazine derivatives, it may exhibit properties such as basicity and the ability to form salts, which can be relevant in drug formulation and development.
Formula:C9H18Cl2N2O
InChI:InChI=1/C9H17ClN2O.ClH/c1-8(2)11-3-5-12(6-4-11)9(13)7-10;/h8H,3-7H2,1-2H3;1H
SMILES:CC(C)N1CCN(CC1)C(=O)CCl.Cl
Synonyms:- 2-Chloro-1-(4-Isopropyl-Piperazin-1-Yl)-Ethanone X Hcl
- 2-Chloro-1-(4-Isopropylpiperazin-1-Yl)Ethanone Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Chloro-1-(4-isopropyl-piperazin-1-yl)-ethanone hydrochloride
CAS:Formula:C9H18Cl2N2OMolecular weight:241.15802-Chloro-1-[4-(propan-2-yl)piperazin-1-yl]ethan-1-one hydrochloride
CAS:2-Chloro-1-[4-(propan-2-yl)piperazin-1-yl]ethan-1-one hydrochloride
Molecular weight:241.15802g/mol2-Chloro-1-(4-isopropyl-piperazin-1-yl)-ethanone hydrochloride
CAS:Formula:C9H18Cl2N2OColor and Shape:SolidMolecular weight:241.16



