CAS 185547-52-8
:FMOC-ASP-PNA
Description:
FMOC-ASP-PNA, with the CAS number 185547-52-8, is a chemical compound that belongs to the class of peptide nucleic acids (PNAs). It is characterized by the incorporation of a fluorenylmethoxycarbonyl (FMOC) protecting group, which is commonly used in solid-phase peptide synthesis to protect amino groups during the synthesis process. The "ASP" in its name indicates that it contains aspartic acid, an amino acid that plays a crucial role in protein synthesis and function. PNAs are known for their ability to bind to complementary nucleic acid sequences with high specificity and affinity, making them valuable tools in molecular biology, diagnostics, and therapeutic applications. FMOC-ASP-PNA exhibits stability against nucleases and proteases, enhancing its potential for use in gene regulation and antisense therapies. Its unique structure allows for the formation of stable duplexes with DNA or RNA, facilitating various applications in genetic research and biotechnology. Overall, FMOC-ASP-PNA is a versatile compound with significant implications in the fields of biochemistry and molecular genetics.
Formula:C25H21N3O7
InChI:InChI=1S/C25H21N3O7/c29-23(30)13-22(24(31)26-15-9-11-16(12-10-15)28(33)34)27-25(32)35-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,31)(H,27,32)(H,29,30)/t22-/m0/s1
InChI key:InChIKey=WIGASSLCYMGNEA-QFIPXVFZSA-N
SMILES:C(OC(N[C@H](C(NC1=CC=C(N(=O)=O)C=C1)=O)CC(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- (3S)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-[(4-nitrophenyl)amino]-4-oxobutanoic acid
- Butanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-[(4-nitrophenyl)amino]-4-oxo-, (3S)-
- Butanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-[(4-nitrophenyl)amino]-4-oxo-, (S)-
- Fmoc-L-Aspartic Acid Alpha-4-Nitroanilide
- Rarechem Em Wb 0076
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
