
CAS 1855888-99-1
:1H-Pyrazole-4-methanamine, 1-(2-fluoroethyl)-, hydrochloride (1:1)
Description:
1H-Pyrazole-4-methanamine, 1-(2-fluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methanamine group and a 2-fluoroethyl substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the fluorine atom may influence its lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The compound's molecular interactions, such as hydrogen bonding and dipole-dipole interactions, can play a significant role in its biological activity. While specific data on its toxicity and safety profile may not be widely available, compounds of this nature are often evaluated for their pharmacological potential, including anti-inflammatory or antimicrobial properties. As with any chemical substance, proper handling and safety precautions are essential when working with this compound in laboratory settings.
Formula:C6H10FN3·ClH
InChI:InChI=1S/C6H10FN3.ClH/c7-1-2-10-5-6(3-8)4-9-10;/h4-5H,1-3,8H2;1H
InChI key:InChIKey=KYKXBZWQPIAAQD-UHFFFAOYSA-N
SMILES:C(CF)N1C=C(CN)C=N1.Cl
Synonyms:- 1H-Pyrazole-4-methanamine, 1-(2-fluoroethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[1-(2-Fluoroethyl)-1H-pyrazol-4-yl]methylamine hydrochloride
CAS:Formula:C6H11ClFN3Molecular weight:179.62
