CAS 1855891-10-9

α,5-Diethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid

Description:

α,5-Diethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a trifluoromethyl group, which significantly enhances its lipophilicity and biological activity. The presence of diethyl groups contributes to its steric bulk, potentially influencing its interaction with biological targets. As an acetic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1855891-10-9, allows for precise identification in chemical databases. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₀H₁₃F₃N₂O₂

InChI: InChI=1S/C10H13F3N2O2/c1-3-6-5-8(10(11,12)13)14-15(6)7(4-2)9(16)17/h5,7H,3-4H2,1-2H3,(H,16,17)

InChI key: InChIKey=XZMWNVOEHOFXBQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CC)N1C(CC)=CC(C(F)(F)F)=N1

Synonyms:

• 2-(5-Ethyl-3-trifluoromethyl-pyrazol-1-yl)-butyric acid
• α,5-Diethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, α,5-diethyl-3-(trifluoromethyl)-
• 2-[5-Ethyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]butanoic acid

2-[5-Ethyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]butanoic acid

CAS: 1855891-10-9

Versatile small molecule scaffold

Formula: C₁₀H₁₃F₃N₂O₂

Purity: Min. 95%

Molecular weight: 250.22 g/mol

Ref: 3D-FZC89110