CAS 1855891-13-2

3-[(1,1-Dimethylethoxy)carbonyl]-1H-pyrazole-1-acetic acid

Description:

3-[(1,1-Dimethylethoxy)carbonyl]-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 1,1-dimethylethoxycarbonyl group enhances its lipophilicity and may influence its solubility in organic solvents. The structure suggests that it could be involved in various chemical reactions, including esterification and amidation, due to the reactive carboxylic acid moiety. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups. As with many pyrazole derivatives, it may also display unique pharmacological properties, warranting further investigation in medicinal chemistry. Overall, this compound represents a versatile structure with potential applications in various fields, including drug development and organic synthesis.

Formula: C₁₀H₁₄N₂O₄

InChI: InChI=1S/C10H14N2O4/c1-10(2,3)16-9(15)7-4-5-12(11-7)6-8(13)14/h4-5H,6H2,1-3H3,(H,13,14)

InChI key: InChIKey=FMVOTCGQWOONAH-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)C1=NN(CC(O)=O)C=C1

Synonyms:

• 3-[(1,1-Dimethylethoxy)carbonyl]-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, 3-[(1,1-dimethylethoxy)carbonyl]-

2-(3-(tert-Butoxycarbonyl)-1H-pyrazol-1-yl)acetic acid

CAS: 1855891-13-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₄

Purity: Min. 95%

Molecular weight: 226.23 g/mol

Ref: 3D-FZC89113