CAS 18559-42-7

4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid

Description:

4-Methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid, with the CAS number 18559-42-7, is a heterocyclic compound featuring a quinoxaline core. This substance is characterized by its fused bicyclic structure, which includes a carboxylic acid functional group and a ketone group. The presence of the methyl group at the 4-position contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. The compound is of interest in medicinal chemistry and may possess biological activity, potentially serving as a scaffold for drug development. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Additionally, the compound's stability and behavior under different conditions, such as pH and temperature, can be significant for its applications in research and industry. Overall, 4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid is a versatile compound with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1/C10H8N2O3/c1-12-7-5-3-2-4-6(7)11-8(9(12)13)10(14)15/h2-5H,1H3,(H,14,15)

SMILES: Cn1c2ccccc2nc(c1=O)C(=O)O

4-Methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid

CAS: 18559-42-7

Formula: C₁₀H₈N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 204.1821

Ref: IN-DA007SYU

4-Methyl-3-oxo-3,4-dihydro-quinoxaline-2-carboxylic acid

CAS: 18559-42-7

Formula: C₁₀H₈N₂O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 204.185

Ref: 10-F060850