CAS 1855906-83-0

2-[(5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-yl)oxy]acetic acid

Description:

2-[(5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-yl)oxy]acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazolo[1,5-a]pyrimidine moiety linked to an acetic acid group via an ether bond. This compound is notable for its potential biological activity, particularly in the realm of medicinal chemistry, where it may exhibit properties relevant to pharmacological applications. The presence of the dimethyl groups on the pyrazolo ring can influence its lipophilicity and overall reactivity. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The compound's molecular interactions may be significant in biological systems, possibly affecting enzyme activity or receptor binding. As with many such compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest for further research in drug development and related fields.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1S/C10H11N3O3/c1-6-3-7(2)13-8(11-6)4-9(12-13)16-5-10(14)15/h3-4H,5H2,1-2H3,(H,14,15)

InChI key: InChIKey=XITQUQRSFADMTJ-UHFFFAOYSA-N

SMILES: CC=1N2C(=CC(OCC(O)=O)=N2)N=C(C)C1

Synonyms:

• 2-[(5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-yl)oxy]acetic acid
• Acetic acid, 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-2-yl)oxy]-

2-({5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-yl}oxy)acetic acid

CAS: 1855906-83-0

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O₃

Purity: Min. 95%

Molecular weight: 221.21 g/mol

Ref: 3D-FZC90683