CAS 1855907-10-6

1H-Pyrazole-5-carboxylic acid, 4-amino-1-(1-methylethyl)-, hydrochloride (1:1)

Description:

1H-Pyrazole-5-carboxylic acid, 4-amino-1-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on its structural attributes and the presence of functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₇H₁₁N₃O₂·ClH

InChI: InChI=1S/C7H11N3O2.ClH/c1-4(2)10-6(7(11)12)5(8)3-9-10;/h3-4H,8H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=MTGJFNJMLDGWOT-UHFFFAOYSA-N

SMILES: C(C)(C)N1C(C(O)=O)=C(N)C=N1.Cl

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 4-amino-1-(1-methylethyl)-, hydrochloride (1:1)

4-Amino-1-(propan-2-yl)-1H-pyrazole-5-carboxylic acid hydrochloride

CAS: 1855907-10-6

Versatile small molecule scaffold

Formula: C₇H₁₂ClN₃O₂

Purity: Min. 95%

Molecular weight: 205.64 g/mol

Ref: 3D-FZC90710