CAS 1855907-32-2

1H-Pyrazol-4-amine, 3-bromo-1-cyclopentyl-, hydrochloride (1:1)

Description:

1H-Pyrazol-4-amine, 3-bromo-1-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 3-position and a cyclopentyl group at the 1-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical research. The compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential for diverse reactivity, including nucleophilic substitution and coupling reactions. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, this compound represents a valuable entity for further exploration in drug development and synthetic chemistry.

Formula: C₈H₁₂BrN₃·ClH

InChI: InChI=1S/C8H12BrN3.ClH/c9-8-7(10)5-12(11-8)6-3-1-2-4-6;/h5-6H,1-4,10H2;1H

InChI key: InChIKey=JEYVINKSJIYIHS-UHFFFAOYSA-N

SMILES: NC1=CN(N=C1Br)C2CCCC2.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 3-bromo-1-cyclopentyl-, hydrochloride (1:1)

3-Bromo-1-cyclopentyl-1H-pyrazol-4-amine hydrochloride

CAS: 1855907-32-2

Versatile small molecule scaffold

Formula: C₈H₁₃BrClN₃

Purity: Min. 95%

Molecular weight: 266.56 g/mol

Ref: 3D-FZC90732