CymitQuimica logo

CAS 185619-66-3

:

Carbamic acid, (3-ethynylphenyl)-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, (3-ethynylphenyl)-, 1,1-dimethylethyl ester, also known by its CAS number 185619-66-3, is an organic compound characterized by the presence of a carbamate functional group. This compound features a phenyl ring substituted with an ethynyl group at the 3-position, which contributes to its unique reactivity and potential applications in organic synthesis. The presence of the tert-butyl ester group enhances its stability and solubility in organic solvents, making it useful in various chemical reactions. Typically, carbamic acid derivatives exhibit moderate to high polarity due to the presence of the carbamate moiety, which can engage in hydrogen bonding. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic reactions. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular structure and the conditions under which it is studied. As with many organic compounds, safety precautions should be taken when handling this substance due to potential toxicity or reactivity.
Formula:C13H15NO2
InChI:InChI=1/C13H15NO2/c1-5-10-7-6-8-11(9-10)14-12(15)16-13(2,3)4/h1,6-9H,2-4H3,(H,14,15)
InChI key:OVWBYRQRBCBWDM-UHFFFAOYSA-N
SMILES:C#Cc1cccc(c1)N=C(O)OC(C)(C)C
Synonyms:
  • Tert-Butyl (3-Ethynylphenyl)Carbamate
Found 4 products.