CAS 185678-56-2
:1-INDAN-1-YL-PIPERAZINE
Description:
1-Indan-1-yl-piperazine is a chemical compound characterized by its unique structure, which consists of an indan moiety fused to a piperazine ring. This compound is often studied for its potential pharmacological properties, particularly in the context of neuropharmacology. It exhibits a range of biological activities, which may include interactions with various neurotransmitter systems, making it of interest in medicinal chemistry. The presence of both the indan and piperazine groups contributes to its lipophilicity and ability to cross biological membranes, which is crucial for its activity in biological systems. Additionally, 1-Indan-1-yl-piperazine may undergo various chemical reactions, including substitutions and modifications, which can lead to the development of derivatives with enhanced or altered properties. Its CAS number, 185678-56-2, is a unique identifier that facilitates the search for information regarding its synthesis, applications, and safety data. Overall, this compound represents a significant area of interest for researchers exploring new therapeutic agents.
Formula:C13H18N2
InChI:InChI=1/C13H18N2/c1-2-4-12-11(3-1)5-6-13(12)15-9-7-14-8-10-15/h1-4,13-14H,5-10H2
SMILES:c1ccc2c(c1)CCC2N1CCNCC1
Synonyms:- 1-Indan-1-Yl-Piperazine >98%
- 1-(2,3-dihydro-1H-inden-1-yl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(2,3-Dihydro-1H-inden-1-yl)piperazine
CAS:<p>1-(2,3-Dihydro-1H-inden-1-yl)piperazine</p>Molecular weight:202.29542g/mol1-Indan-1-yl-piperazine
CAS:Controlled Product<p>1-Indan-1-yl-piperazine is a compound that can be found in the leaves of the Piper plant, which is a genus of flowering plants. It is a neutralizing agent and has been used as an anti-depressant drug. This compound has been shown to have a condensation reaction with indanone, which is another class of compounds. This reaction yields 1,4-dihydropyridines, which are able to bind to potassium ion channels on the cell membrane and inhibit their function.</p>Formula:C13H18N2Purity:Min. 95%Molecular weight:202.3 g/mol



