CAS 185693-02-1

HEXAHYDRO-PYRROLO[3,4-B]PYRROLE-1-CARBOXYLIC ACID TERT-BUTYL ESTER

Description:

Hexahydro-pyrrolo[3,4-b]pyrrole-1-carboxylic acid tert-butyl ester is a chemical compound characterized by its unique bicyclic structure, which includes a pyrrolidine ring fused to a pyrrole ring. This compound typically exhibits properties associated with both amines and carboxylic acids due to the presence of these functional groups. It is often used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The tert-butyl ester group enhances its solubility and stability, making it a useful intermediate in various chemical reactions. The compound is generally stable under standard laboratory conditions but may require careful handling due to potential reactivity associated with the carboxylic acid moiety. Its applications may extend to areas such as agrochemicals or materials science, depending on the specific derivatives synthesized from it. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines to ensure safe laboratory practices.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1/C11H20N2O2/c1-11(2,3)15-10(14)13-5-4-8-6-12-7-9(8)13/h8-9,12H,4-7H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC2CNCC12

Synonyms:

• tert-butyl 3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxylate
• Tert-Butyl Hexahydropyrrolo[3,4-B]Pyrrole-1(2H)-Carboxylate

tert-Butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

CAS: 185693-02-1

Formula: C₁₁H₂₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 212.2887

Ref: IN-DA0076NZ

tert-Butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

CAS: 185693-02-1

tert-Butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

Purity: 97%

Molecular weight: 212.29g/mol

Ref: 54-OR86014

tert-Butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

CAS: 185693-02-1

Formula: C₁₁H₂₀N₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 212.152

Ref: 10-F312452