CymitQuimica logo

CAS 1857-18-7

:

3-amino-N,N-dimethyl-Propanamide

Description:
3-Amino-N,N-dimethylpropanamide, with the CAS number 1857-18-7, is an organic compound characterized by the presence of an amide functional group and an amino group. It features a propanamide backbone, where the nitrogen atom is substituted with two methyl groups, contributing to its dimethylamine characteristics. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The amino group can act as a weak base, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its structure suggests potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C5H12N2O
InChI:InChI=1S/C5H12N2O/c1-7(2)5(8)3-4-6/h3-4,6H2,1-2H3
InChI key:JNDIDJUNNCBHTI-UHFFFAOYSA-N
SMILES:CN(C)C(=O)CCN
Synonyms:
  • Propanamide, 3-amino-N,N-dimethyl-
Found 5 products.