CAS 1857-19-8
:2-amino-N,N-dimethylacetamide
Description:
2-Amino-N,N-dimethylacetamide, with the CAS number 1857-19-8, is an organic compound characterized by its amide functional group. It features a central acetamide structure with two methyl groups attached to the nitrogen atom, contributing to its dimethyl substitution. This compound is typically a colorless to pale yellow liquid at room temperature and is soluble in water and various organic solvents, reflecting its polar nature. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 2-Amino-N,N-dimethylacetamide is often used as a solvent or reagent in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its relatively low toxicity and ability to stabilize reactive intermediates make it valuable in laboratory settings. However, like many amides, it may undergo hydrolysis under certain conditions, leading to the formation of corresponding acids and amines. Proper handling and safety measures should be observed due to its chemical reactivity and potential health effects.
Formula:C4H11N2O
InChI:InChI=1/C4H10N2O/c1-6(2)4(7)3-5/h3,5H2,1-2H3/p+1
Synonyms:- acetamide, 2-amino-N,N-dimethyl-
- N,N-Dimethylglycinamid
- N,N-Dimethylglycinamide
- 2-(Dimethylamino)-2-Oxoethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Glycine dimethylamide, 97%
CAS:Glycine dimethylamide is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference h
Formula:C4H11N2OPurity:97%Color and Shape:Clear colorless, LiquidMolecular weight:103.142-Amino-N,N-dimethylacetamide
CAS:Formula:C4H10N2OPurity:95%Color and Shape:LiquidMolecular weight:102.13502-Amino-N,N-dimethylacetamide
CAS:2-Amino-N,N-dimethylacetamideFormula:C4H10N2OPurity:99%Color and Shape: colorless liquidMolecular weight:102.14g/mol2-Amino-N,N-dimethylacetamide
CAS:Formula:C4H10N2OPurity:95%Color and Shape:LiquidMolecular weight:102.137



