CymitQuimica logo

CAS 1858250-03-9

:

Ethyl 2-methyl-5-[4-(trifluoromethoxy)phenyl]-3-furancarboxylate

Description:
Ethyl 2-methyl-5-[4-(trifluoromethoxy)phenyl]-3-furancarboxylate is an organic compound characterized by its complex structure, which includes a furan ring, an ethyl ester group, and a trifluoromethoxy-substituted phenyl group. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents due to its polar functional groups. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. The furan ring contributes to its aromatic character, potentially allowing for various electrophilic substitution reactions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new compounds with specific biological activities. Overall, the unique combination of functional groups in Ethyl 2-methyl-5-[4-(trifluoromethoxy)phenyl]-3-furancarboxylate contributes to its distinctive chemical behavior and potential utility in various fields.
Formula:C15H13F3O4
InChI:InChI=1S/C15H13F3O4/c1-3-20-14(19)12-8-13(21-9(12)2)10-4-6-11(7-5-10)22-15(16,17)18/h4-8H,3H2,1-2H3
InChI key:InChIKey=VYYYTJMKUZZWEE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(OC1C)C2=CC=C(OC(F)(F)F)C=C2
Synonyms:
  • 3-Furancarboxylic acid, 2-methyl-5-[4-(trifluoromethoxy)phenyl]-, ethyl ester
  • Ethyl 2-methyl-5-[4-(trifluoromethoxy)phenyl]-3-furancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.