CAS 1858251-13-4

1H-Pyrrole-2-sulfonamide, 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methyl-

Description:

1H-Pyrrole-2-sulfonamide, 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methyl- is a chemical compound characterized by its unique structure, which includes a pyrrole ring, a sulfonamide group, and a substituted phenyl moiety. The presence of the dichloro and trifluoromethyl groups on the phenyl ring contributes to its potential biological activity and lipophilicity. This compound is likely to exhibit properties typical of sulfonamides, such as antibacterial activity, although specific biological data would be necessary to confirm its efficacy. The molecular structure suggests that it may participate in hydrogen bonding due to the sulfonamide functional group, influencing its solubility and reactivity. Additionally, the presence of halogen substituents can enhance its stability and alter its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents. However, detailed studies would be required to fully elucidate its properties and potential applications.

Formula: C₁₂H₉Cl₂F₃N₂O₂S

InChI: InChI=1S/C12H9Cl2F3N2O2S/c1-18-22(20,21)10-3-2-4-19(10)11-8(13)5-7(6-9(11)14)12(15,16)17/h2-6,18H,1H3

InChI key: InChIKey=MMEPEFKGLZKCTN-UHFFFAOYSA-N

SMILES: S(NC)(=O)(=O)C=1N(C=CC1)C2=C(Cl)C=C(C(F)(F)F)C=C2Cl

Synonyms:

• 1H-Pyrrole-2-sulfonamide, 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methyl-
• 1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-N-methyl-1H-pyrrole-2-sulfonamide

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-N-methyl-1H-pyrrole-2-sulfonamide

CAS: 1858251-13-4

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-N-methyl-1H-pyrrole-2-sulfonamide

Purity: ≥95%

Molecular weight: 373.18g/mol

Ref: 54-PC300857