CAS 1858251-38-3

Ethyl 2-(3-aminophenyl)-4-phenyl-5-thiazolecarboxylate

Description:

Ethyl 2-(3-aminophenyl)-4-phenyl-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 3-aminophenyl group indicates that it has an amino substituent on the aromatic ring, which can participate in hydrogen bonding and enhance its biological activity. The phenyl groups attached to the thiazole ring may influence the compound's electronic properties and steric hindrance, potentially affecting its interactions with biological targets. This compound is of interest in medicinal chemistry and may exhibit various pharmacological activities, although specific biological properties would require further investigation. Its molecular structure suggests potential applications in drug development, particularly in areas related to cancer or infectious diseases, where thiazole derivatives have shown promise. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₆N₂O₂S

InChI: InChI=1S/C18H16N2O2S/c1-2-22-18(21)16-15(12-7-4-3-5-8-12)20-17(23-16)13-9-6-10-14(19)11-13/h3-11H,2,19H2,1H3

InChI key: InChIKey=BYQZYKUCDBXCSW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(N=C(S1)C2=CC(N)=CC=C2)C3=CC=CC=C3

Synonyms:

• 5-Thiazolecarboxylic acid, 2-(3-aminophenyl)-4-phenyl-, ethyl ester
• Ethyl 2-(3-aminophenyl)-4-phenyl-5-thiazolecarboxylate

Ethyl 2-(3-aminophenyl)-4-phenylthiazole-5-carboxylate

CAS: 1858251-38-3

Molecular weight: 324.3999938964844

Ref: 10-F097988