CAS 1858251-52-1

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1H-pyrrole-2-sulfonyl chloride

Description:

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1H-pyrrole-2-sulfonyl chloride is a chemical compound characterized by its complex structure, which includes a pyrrole ring and a sulfonyl chloride functional group. This compound features a dichlorophenyl moiety substituted with a trifluoromethyl group, contributing to its unique chemical properties. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The dichloro and trifluoromethyl substituents enhance its lipophilicity and may influence its biological activity, potentially making it relevant in pharmaceutical applications. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the halogen substituents. Overall, this compound is of interest in the fields of medicinal chemistry and materials science, where its properties can be exploited for the development of new drugs or functional materials.

Formula: C₁₁H₅Cl₃F₃NO₂S

InChI: InChI=1S/C11H5Cl3F3NO2S/c12-7-4-6(11(15,16)17)5-8(13)10(7)18-3-1-2-9(18)21(14,19)20/h1-5H

InChI key: InChIKey=TWMGIEXDKKSTBK-UHFFFAOYSA-N

SMILES: ClC1=C(C(Cl)=CC(C(F)(F)F)=C1)N2C(S(Cl)(=O)=O)=CC=C2

Synonyms:

• 1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1H-pyrrole-2-sulfonyl chloride
• 1H-Pyrrole-2-sulfonyl chloride, 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1H-pyrrole-2-sulfonyl chloride

CAS: 1858251-52-1

1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1H-pyrrole-2-sulfonyl chloride

Purity: ≥95%

Molecular weight: 378.58g/mol

Ref: 54-PC300855