CAS 1858255-57-8: 2,3,5-Trifluoro-4-(1-piperidinyl)benzoic acid

Description:2,3,5-Trifluoro-4-(1-piperidinyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with trifluoromethyl groups and a piperidine ring. The presence of three fluorine atoms contributes to its lipophilicity and potential biological activity, making it of interest in medicinal chemistry. The piperidine group enhances its ability to interact with biological targets, potentially influencing its pharmacological properties. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can participate in hydrogen bonding and ionic interactions. Its molecular structure suggests that it may have applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Additionally, the trifluoromethyl groups can enhance metabolic stability and influence the compound's solubility and permeability. Overall, 2,3,5-Trifluoro-4-(1-piperidinyl)benzoic acid represents a class of fluorinated compounds that are valuable in various chemical and pharmaceutical applications.

Formula:C₁₂H₁₂F₃NO₂

InChI:InChI=1S/C12H12F3NO2/c13-8-6-7(12(17)18)9(14)10(15)11(8)16-4-2-1-3-5-16/h6H,1-5H2,(H,17,18)

InChI key:InChIKey=HZNWIJYBGWXPAS-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(F)=C(C(F)=C1F)N2CCCCC2