CAS 1858257-24-5
:Methyl 2-[[(4-chlorophenyl)methyl](phenylsulfonyl)amino]benzoate
Description:
Methyl 2-[[(4-chlorophenyl)methyl](phenylsulfonyl)amino]benzoate, identified by its CAS number 1858257-24-5, is a synthetic organic compound characterized by its complex molecular structure that includes a benzoate moiety, a sulfonamide group, and a chlorophenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of the sulfonamide group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the chlorophenyl group may influence its electronic properties and reactivity. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Overall, this compound's unique structure positions it as a candidate for further research in pharmaceutical applications or as a chemical intermediate.
Formula:C21H18ClNO4S
InChI:InChI=1S/C21H18ClNO4S/c1-27-21(24)19-9-5-6-10-20(19)23(15-16-11-13-17(22)14-12-16)28(25,26)18-7-3-2-4-8-18/h2-14H,15H2,1H3
InChI key:InChIKey=LVHFBBRYAIBYSP-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CC=C1)(CC2=CC=C(Cl)C=C2)C3=C(C(OC)=O)C=CC=C3
Synonyms:- Methyl 2-[[(4-chlorophenyl)methyl](phenylsulfonyl)amino]benzoate
- Benzoic acid, 2-[[(4-chlorophenyl)methyl](phenylsulfonyl)amino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.