CymitQuimica logo

CAS 185848-10-6

:

α-(4-Methoxyphenyl)-4-pyrimidineethanol

Description:
α-(4-Methoxyphenyl)-4-pyrimidineethanol, with the CAS number 185848-10-6, is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a methoxyphenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its functional groups. The presence of the hydroxyl (-OH) group suggests it may engage in hydrogen bonding, influencing its interactions in biological systems. Additionally, the methoxy group can enhance lipophilicity, affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role in modulating biological pathways. Its specific reactivity and stability can vary based on environmental conditions, such as pH and temperature. Overall, α-(4-Methoxyphenyl)-4-pyrimidineethanol represents a class of compounds that may have applications in drug discovery and development, warranting further investigation into its biological activities and therapeutic potential.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c1-17-12-4-2-10(3-5-12)13(16)8-11-6-7-14-9-15-11/h2-7,9,13,16H,8H2,1H3
InChI key:InChIKey=NCDZMQADLRAVOK-UHFFFAOYSA-N
SMILES:C(CC=1C=CN=CN1)(O)C2=CC=C(OC)C=C2
Synonyms:
  • 4-Pyrimidineethanol, α-(4-methoxyphenyl)-
  • 1-(4-Methoxyphenyl)-2-pyrimidin-4-ylethanol
  • 1-(4-Methoxyphenyl)-2-(pyrimidin-4-yl)ethanol
  • α-(4-Methoxyphenyl)-4-pyrimidineethanol
Found 3 products.