CAS 185990-03-8
:2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique structure that includes a dioxaborolane ring and a dimethylphenylsilyl substituent. This compound typically exhibits properties associated with boron-containing compounds, such as potential reactivity in cross-coupling reactions, making it valuable in organic synthesis and materials science. The presence of the dioxaborolane moiety suggests it may participate in various chemical transformations, including nucleophilic attacks and coordination with other reagents. Its silane component can enhance solubility and stability in organic solvents, while the tetramethyl groups contribute to steric hindrance, influencing its reactivity and interaction with other molecules. Additionally, this compound may exhibit interesting electronic properties due to the presence of both silicon and boron, which can affect its behavior in catalytic processes. Overall, 2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a versatile compound with potential applications in synthetic chemistry and materials development.
Formula:C14H23BO2Si
InChI:InChI=1/C14H23BO2Si/c1-13(2)14(3,4)17-15(16-13)18(5,6)12-10-8-7-9-11-12/h7-11H,1-6H3
SMILES:CC1(C)C(C)(C)OB(O1)[Si](C)(C)c1ccccc1
Synonyms:- (Dimethylphenylsilyl)boronic acid pinacol ester
- Dimethyl(Phenyl)(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl(phenyl)(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane
CAS:Formula:C14H23BO2SiPurity:90%Color and Shape:LiquidMolecular weight:262.2277(Dimethylphenylsilyl)Boronic Acid Pinacol Ester
CAS:<p>(Dimethylphenylsilyl)Boronic Acid Pinacol Ester</p>Purity:90%Molecular weight:262.23g/mol2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C14H23BO2SiPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:262.23(Dimethylphenylsilyl)boronic acid pinacol ester
CAS:Formula:C14H23BO2SiPurity:90%Color and Shape:LiquidMolecular weight:262.232-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:<p>2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a chiral ligand that can be used in asymmetric synthesis. It has been shown to be effective in the palladium-catalyzed cross-coupling of aldehydes with organoboronic acids. 2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane inhibits the formation of an undesired enolate by binding to the silicon atom and sterically preventing nucleophilic attack at this site. This ligand is also selective for anions with a single negative charge such as chloride and bromide.</p>Formula:C14H23BO2SiPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:262.23 g/mol




