CAS 1860012-50-5

2-Piperazinemethanol, 4-(phenylmethyl)-, hydrochloride (1:2), (2S)-

Description:

2-Piperazinemethanol, 4-(phenylmethyl)-, hydrochloride (1:2), (2S)- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenylmethyl group attached to the piperazine, contributing to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The (2S)- designation indicates the specific stereochemistry of the molecule, which can significantly influence its pharmacological properties. Compounds with piperazine moieties are often investigated for their roles in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders. The presence of the phenylmethyl group may also suggest potential interactions with various biological targets, making this compound of interest in drug discovery and development. Overall, its unique structure and properties position it as a candidate for further research in therapeutic applications.

Formula: C₁₂H₁₈N₂O·2ClH

InChI: InChI=1S/C12H18N2O.2ClH/c15-10-12-9-14(7-6-13-12)8-11-4-2-1-3-5-11;;/h1-5,12-13,15H,6-10H2;2*1H/t12-;;/m0../s1

InChI key: InChIKey=WSABKJNYYBAXPM-LTCKWSDVSA-N

SMILES: C(N1C[C@@H](CO)NCC1)C2=CC=CC=C2.Cl

Synonyms:

• 2-Piperazinemethanol, 4-(phenylmethyl)-, hydrochloride (1:2), (2S)-

(S)-4-Benzyl-2-hydroxymethylpiperazine 2hcl

CAS: 1860012-50-5

Formula: C₁₂H₂₀Cl₂N₂O

Purity: 96%

Molecular weight: 279.2060

Ref: IN-DA00IL0B

[(2S)-4-Benzylpiperazin-2-yl]methanol dihydrochloride

CAS: 1860012-50-5

[(2S)-4-Benzylpiperazin-2-yl]methanol dihydrochloride

Purity: 96%

Molecular weight: 279.21g/mol

Ref: 54-OR76408

[(2S)-4-benzylpiperazin-2-yl]methanol dihydrochloride

CAS: 1860012-50-5

Formula: C₁₂H₂₀Cl₂N₂O

Purity: 96%

Molecular weight: 279.21

Ref: 10-F516987