CAS 1860028-17-6

2-Benzothiazolamine, 4-methoxy-7-(4-morpholinyl)-, hydrobromide (1:2)

Description:

2-Benzothiazolamine, 4-methoxy-7-(4-morpholinyl)-, hydrobromide (1:2) is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a morpholine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group enhances its solubility and may influence its reactivity and interaction with biological targets. As a hydrobromide salt, it is likely to be more stable and soluble in aqueous environments compared to its free base form. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its mechanism of action, toxicity, and efficacy in biological systems. As with many chemical substances, safety data sheets should be consulted for handling and usage guidelines, particularly regarding its potential hazards and environmental impact.

Formula: C₁₂H₁₅N₃O₂S·2BrH

InChI: InChI=1S/C12H15N3O2S.2BrH/c1-16-9-3-2-8(15-4-6-17-7-5-15)11-10(9)14-12(13)18-11;;/h2-3H,4-7H2,1H3,(H2,13,14);2*1H

InChI key: InChIKey=IPERMCRKZIFQGU-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(C=C1)N3CCOCC3)SC(N)=N2.Br

Synonyms:

• 2-Benzothiazolamine, 4-methoxy-7-(4-morpholinyl)-, hydrobromide (1:2)

4-methoxy-7-(morpholin-4-yl)-1,3-benzothiazol-2-amine dihydrobromide

CAS: 1860028-17-6

Formula: C₁₂H₁₇Br₂N₃O₂S

Purity: 97%

Molecular weight: 427.1553

Ref: IN-DA00I1Q2

4-Methoxy-7-(morpholin-4-yl)-1,3-benzothiazol-2-amine dihydrobromide

CAS: 1860028-17-6

Purity: 97%

Molecular weight: 427.1600037

Ref: 10-F614156