CAS 186020-66-6
:tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate
Description:
Tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate, with CAS number 186020-66-6, is an organic compound characterized by its complex structure, which includes a tert-butyl group and multiple ethoxy units. This compound is typically a colorless to pale yellow liquid, exhibiting moderate viscosity. It is soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water due to the hydrophobic tert-butyl group. The presence of the hydroxyethoxy moiety suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other substances. This compound may be used in various applications, including as an intermediate in organic synthesis or in formulations requiring specific solubility and stability characteristics. Its chemical stability is generally good under standard conditions, although it should be handled with care to avoid exposure to extreme temperatures or reactive agents. As with many organic compounds, safety data sheets should be consulted for proper handling and potential hazards.
Formula:C13H26O6
InChI:InChI=1/C13H26O6/c1-13(2,3)19-12(15)4-6-16-8-10-18-11-9-17-7-5-14/h14H,4-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)CCOCCOCCOCCO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
tert-Butyl 12-Hydroxy-4,7,10-trioxadodecanoate
CAS:Formula:C13H26O6Purity:>97.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:278.35TERT-BUTYL 12-HYDROXY-4 7 10-TRIOXA-
CAS:Formula:C13H26O6Purity:97%Color and Shape:LiquidMolecular weight:278.3419Ref: IN-DA003UJ0
1g31.00€5g65.00€10g99.00€1kgTo inquire25g156.00€50g213.00€100g536.00€250gTo inquire500gTo inquire100mg26.00€250mg24.00€Hydroxy-PEG3-(CH2)2-Boc
CAS:<p>Hydroxy-PEG2-(CH2)2-Boc, an uncleavable ADC linker from patent WO2004008101A2.</p>Formula:C13H26O6Color and Shape:SolidMolecular weight:278.34Hydroxy-PEG3-t-butyl ester
CAS:<p>Hydroxy-PEG3-t-butyl ester</p>Formula:C13H26O6Purity:By hplc: 99.8% (Typical Value in Batch COA)Color and Shape: oilMolecular weight:278.34g/moltert-Butyl 3-(2-(2-(2-hydroxyethoxy)ethoxy)ethoxy)propanoate
CAS:Formula:C13H26O6Purity:95%Color and Shape:LiquidMolecular weight:278.345





