CAS 186097-54-1

DK-AH 269

Description:

DK-AH 269, identified by its CAS number 186097-54-1, is a chemical compound that has garnered attention in various research contexts, particularly in the field of medicinal chemistry. While specific characteristics such as its molecular structure, physical properties, and biological activity may vary, compounds like DK-AH 269 are often evaluated for their potential therapeutic applications. Typically, such substances may exhibit properties such as solubility in organic solvents, stability under certain conditions, and specific reactivity profiles that make them suitable for drug development. Additionally, they may interact with biological targets, influencing pathways relevant to disease treatment. The compound's safety profile, including toxicity and pharmacokinetics, is also crucial for its evaluation in preclinical and clinical studies. For precise details regarding its characteristics, including empirical formula, melting point, and specific applications, consulting specialized chemical databases or scientific literature is recommended, as these resources provide comprehensive and up-to-date information on chemical substances.

Formula: C₂₈H₃₉ClN₂O₅

InChI: InChI=1/C28H38N2O5.ClH/c1-32-24-8-7-20(14-25(24)33-2)9-12-29-11-5-6-21(18-29)19-30-13-10-22-15-26(34-3)27(35-4)16-23(22)17-28(30)31;/h7-8,14-16,21H,5-6,9-13,17-19H2,1-4H3;1H/t21-;/m0./s1

SMILES: COc1ccc(CCN2CCC[C@@H](C2)CN2CCc3cc(c(cc3CC2=O)OC)OC)cc1OC.Cl

Synonyms:

• Cilobradine hydrochloride, (S)-(+)-7,8-Dimethoxy-3-[[1-(2-(3,4-dimethoxyphenyl)ethyl)-3-piperidinyl]methyl]-1,3,4,5-tetrahydro-2H-3-benzazepin-2-one hydrochloride
• 3-({(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-3-yl}methyl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2H-3-benzazepin-2-one hydrochloride

DK-AH 269

CAS: 186097-54-1

Formula: C₂₈H₃₉ClN₂O₅

Purity: 98%

Molecular weight: 519.0727

Ref: IN-DA003PSI

Cilobradine hydrochloride

CAS: 186097-54-1

Cilobradine hydrochloride

Purity: ≥95%

Molecular weight: 519.07g/mol

Ref: 54-BUP00486

Cilobradine hydrochloride

CAS: 186097-54-1

Cilobradine hydrochloride (DK-AH 269) is an HCN Channel blocker and an open channel blocker of neuronal Ih and related cardiac If channels.

Formula: C₂₈H₃₉ClN₂O₅

Purity: 98.40%

Color and Shape: Solid

Molecular weight: 519.07

Ref: TM-T10813