CAS 18619-21-1

2-[(2-Methoxyphenyl)thio]acetic acid

Description:

2-[(2-Methoxyphenyl)thio]acetic acid, with the CAS number 18619-21-1, is an organic compound characterized by the presence of a thioether functional group and a carboxylic acid. This compound features a methoxy-substituted phenyl group attached to a sulfur atom, which is further linked to an acetic acid moiety. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The thioether linkage contributes to its unique chemical reactivity and may play a role in its interactions with biological systems. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could impart specific biological activities. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic potential would be necessary to fully understand its applications in these fields.

Formula: C₉H₁₀O₃S

InChI: InChI=1S/C9H10O3S/c1-12-7-4-2-3-5-8(7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)

InChI key: InChIKey=UGPJOWVEIXPMSH-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=C(OC)C=CC=C1

Synonyms:

• Acetic acid, [(2-methoxyphenyl)thio]-
• 2-Methoxyphenylthioacetic acid
• Acetic acid, 2-[(2-methoxyphenyl)thio]-
• Acetic acid, [(o-methoxyphenyl)thio]-
• 2-[(2-Methoxyphenyl)thio]acetic acid

Acetic acid, [(2-methoxyphenyl)thio]-

CAS: 18619-21-1

Formula: C₉H₁₀O₃S

Purity: 95%

Molecular weight: 198.2389

Ref: IN-DA00I1QI

2-((2-Methoxyphenyl)thio)acetic acid

CAS: 18619-21-1

2-((2-Methoxyphenyl)thio)acetic acid

Purity: 95%

Molecular weight: 198.24g/mol

Ref: 54-OR1045445

(2-Methoxy-phenylsulfanyl)-acetic acid

CAS: 18619-21-1

Versatile small molecule scaffold

Formula: C₉H₁₀O₃S

Purity: Min. 95%

Molecular weight: 198.24 g/mol

Ref: 3D-TAA61921