CAS 1862-41-5
:anonaine
Description:
Anonaine, with the CAS number 1862-41-5, is an alkaloid primarily derived from the Annonaceae family of plants, particularly from species such as Annona muricata (soursop). This compound is characterized by its complex molecular structure, which includes a bicyclic framework. Anonaine exhibits a range of biological activities, including potential anti-cancer properties, and has been studied for its effects on various cellular processes. It is known to interact with multiple biological targets, which may contribute to its pharmacological effects. The compound is typically found in low concentrations in plant extracts, and its extraction and purification require specific methodologies. Anonaine's solubility properties are influenced by its chemical structure, making it more soluble in organic solvents than in water. As research continues, the full scope of its therapeutic potential and mechanisms of action is still being explored, highlighting the importance of further studies in natural product chemistry and pharmacology.
Formula:C17H15NO2
InChI:InChI=1/C17H15NO2/c1-2-4-12-10(3-1)7-13-15-11(5-6-18-13)8-14-17(16(12)15)20-9-19-14/h1-4,8,13,18H,5-7,9H2/t13-/m1/s1
InChI key:InChIKey=VZTUKBKUWSHDFM-CYBMUJFWSA-N
SMILES:C=12C3=C4C(=CC1CCN[C@@]2(CC=5C3=CC=CC5)[H])OCO4
Synonyms:- (7aR)-6,7,7a,8-Tetrahydro-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline
- (7aR)-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline
- (R)-Annonaine
- 1,2-(Methylenedioxy)-6aβ-noraporphine
- 5H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinoline, 6,7,7a,8-tetrahydro-, (R)-
- 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline, 6,7,7a,8-tetrahydro-, (7aR)-
- 6aβ-Noraporphine, 1,2-(methylenedioxy)-
- Anonain
- Vtl 040
- Anonaine
- anonaine USP/EP/BP
- (-)-annonaine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(-)-Anonaine
CAS:(-)-Anonaine is a natural alkaloid with potential anticancer properties. It has been shown to inhibit the growth of tumor cells by blocking the cell cycle and inducing apoptosis. (-)-Anonaine has also been found to inhibit human kinase activity, which plays a key role in cancer cell proliferation. This compound has been isolated from Chinese medicinal plants and can be detected in urine samples after consumption. (-)-Anonaine may have potential as an inhibitor of leukemia and other cancer cells due to its ability to target specific proteins involved in cancer development. Further research is needed to fully understand the mechanisms behind its anticancer effects.Formula:C17H15NO2Purity:Min. 95%Molecular weight:265.31 g/mol(-)-Anonaine
CAS:(-)-Anonaine can be extracted from several species of Magnoliaceae and Annelidae and has antimalarial, antibacterial, antifungal, antioxidant, anticancer,Formula:C17H15NO2Purity:98.21% - 98.63%Color and Shape:SolidMolecular weight:265.31



