CAS 18620-03-6: bromo-(4-isopropylphenyl)magnesium

Description:Bromo-(4-isopropylphenyl)magnesium, with the CAS number 18620-03-6, is an organomagnesium compound that belongs to the class of Grignard reagents. These reagents are characterized by their highly reactive nature, particularly towards electrophiles, due to the presence of a carbon-magnesium bond. This specific compound features a bromo substituent on a phenyl ring that is further substituted with an isopropyl group, enhancing its steric properties. The presence of the bromine atom makes it a suitable precursor for nucleophilic substitution reactions, allowing for the introduction of various functional groups. Grignard reagents like this one are typically used in organic synthesis to form carbon-carbon bonds, facilitating the construction of complex organic molecules. However, they are sensitive to moisture and air, requiring an anhydrous environment for stability and reactivity. Overall, bromo-(4-isopropylphenyl)magnesium is a valuable reagent in synthetic organic chemistry, particularly in the formation of new carbon frameworks.

Formula:C₉H₁₁BrMg

InChI:InChI=1/C9H11.BrH.Mg/c1-8(2)9-6-4-3-5-7-9;;/h4-8H,1-2H3;1H;/q;;+1/p-1/rC9H11BrMg/c1-7(2)8-3-5-9(11-10)6-4-8/h3-7H,1-2H3