CAS 18620-73-0
:2-4-diamino-5-nitropyrimidine
Description:
2,4-Diamino-5-nitropyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two amino groups (-NH2) at the 2 and 4 positions and a nitro group (-NO2) at the 5 position, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The presence of both amino and nitro functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 2,4-Diamino-5-nitropyrimidine is of interest in medicinal chemistry and agricultural applications, particularly as a precursor in the synthesis of pharmaceuticals and agrochemicals. As with many nitrogen-containing compounds, it may also exhibit biological activity, making it a subject of research in drug development and other scientific studies.
Formula:C4H5N5O2
InChI:InChI=1/C4H5N5O2/c5-3-2(9(10)11)1-7-4(6)8-3/h1H,(H4,5,6,7,8)
SMILES:c1c(c(=N)[nH]c(=N)[nH]1)N(=O)=O
Synonyms:- 2,4-Diamino-5-Nitropyrimidine
- 5-Nitropyrimidine-2,4-Diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Nitropyrimidine-2,4-diamine
CAS:Formula:C4H5N5O2Purity:95%Color and Shape:SolidMolecular weight:155.11485-Nitropyrimidine-2,4-diamine
CAS:5-Nitropyrimidine-2,4-diaminePurity:95%Molecular weight:155.11g/mol2,4-Diamino-5-nitropyrimidine
CAS:2,4-Diamino-5-nitropyrimidine is a synthetic molecule that belongs to the class of heterocyclic amines. It has been shown to be a potent antiproliferative agent and has been found to inhibit hepg2 cell growth in vitro. This compound was also found to inhibit cancer cells, including mcf-7. 2,4-Diamino-5-nitropyrimidine binds nucleophilic sites on proteins and inhibits enzymes involved in DNA synthesis. The inhibition of these enzymes leads to cell death by preventing the production of new proteins needed for cell division.Formula:C4H5N5O2Purity:Min. 95%Color and Shape:Off-White To Yellow SolidMolecular weight:155.12 g/mol



