CAS 18621-22-2
:1-(4-Bromophenoxy)-2-propanone
Description:
1-(4-Bromophenoxy)-2-propanone, with the CAS number 18621-22-2, is an organic compound characterized by its structure, which features a bromophenyl group attached to a propanone moiety through an ether linkage. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic bromophenyl group. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, 1-(4-Bromophenoxy)-2-propanone serves as a valuable intermediate in organic synthesis and research.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-7(11)6-12-9-4-2-8(10)3-5-9/h2-5H,6H2,1H3
InChI key:InChIKey=CFPFUJANAPAZSH-UHFFFAOYSA-N
SMILES:O(CC(C)=O)C1=CC=C(Br)C=C1
Synonyms:- 1-(4-Bromophenoxy)-2-propanone
- 2-Propanone, 1-(4-bromophenoxy)-
- 2-Propanone, 1-(p-bromophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.