CAS 186320-23-0

4-[(4-methylpyridin-2-yl)amino]-4-oxobutanoic acid

Description:

4-[(4-methylpyridin-2-yl)amino]-4-oxobutanoic acid, with the CAS number 186320-23-0, is an organic compound characterized by its unique structure that includes a pyridine ring and a carboxylic acid functional group. This compound features a butanoic acid backbone with a ketone and an amino group attached to the fourth carbon, contributing to its reactivity and potential biological activity. The presence of the 4-methylpyridine moiety suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, which can participate in hydrogen bonding. Its molecular structure may allow for various chemical modifications, enhancing its utility in research and development. Additionally, the compound's properties, such as melting point, boiling point, and stability, would depend on environmental conditions and specific formulations. Overall, this compound represents a class of molecules that could have applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₂N₂O₃

InChI: InChI=1/C10H12N2O3/c1-7-4-5-11-8(6-7)12-9(13)2-3-10(14)15/h4-6H,2-3H2,1H3,(H,14,15)(H,11,12,13)

SMILES: Cc1ccnc(c1)N=C(CCC(=O)O)O

Synonyms:

• 4-[(4-Methyl-2-Pyridyl)Amino]-4-Oxobutanoic Acid
• Butanoic Acid, 4-[(4-Methyl-2-Pyridinyl)Amino]-4-Oxo-

4-[(4-Methyl-2-pyridinyl)amino]-4-oxobutanoic acid

CAS: 186320-23-0

4-[(4-Methyl-2-pyridinyl)amino]-4-oxobutanoic acid

Purity: 95%

Molecular weight: 208.21g/mol

Ref: 54-OR1002730

4-[(4-methyl-2-pyridinyl)amino]-4-oxobutanoic acid

CAS: 186320-23-0

Formula: C₁₀H₁₂N₂O₃

Purity: 95.0%

Molecular weight: 208.217

Ref: 10-F314183